C12H16O5 — CID 134968723
(3S,6S)-2-(hydroxymethyl)-6-phenyloxane-3,4,5-triol (PubChem CID 134968723) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (3S,6S)-2-(hydroxymethyl)-6-phenyloxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-(hydroxymethyl)-6-phenyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 134968723 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (3S,6S)-2-(hydroxymethyl)-6-phenyloxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](c2ccccc2)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C12H16O5/c13-6-8-9(14)10(15)11(16)12(17-8)7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8?,9-,10?,11?,12+/m1/s1 |
| InChIKey | NOFZOJZALFHRLE-FSKVMLQNSA-N |
| XLogP | -0.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |