C12H15BrO5 — CID 125425129
(2R,3R,4R,5S,6S)-2-(4-bromophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 125425129) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-(4-bromophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6S)-2-(4-bromophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 125425129 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-(4-bromophenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@H]1O[C@H](c2ccc(Br)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H15BrO5/c13-7-3-1-6(2-4-7)12-11(17)10(16)9(15)8(5-14)18-12/h1-4,8-12,14-17H,5H2/t8-,9+,10-,11+,12+/m0/s1 |
| InChIKey | AVRZQJFQFLQQAY-RNWYCLNJSA-N |
| XLogP | -0.04 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |