C13H17BrO6 — CID 71730535
(2R,3S,4R,5S,6R)-2-(4-bromo-3-methoxyphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71730535) has the molecular formula C13H17BrO6 and a molecular weight of 349.18 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-(4-bromo-3-methoxyphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-(4-bromo-3-methoxyphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71730535 |
| Molecular Formula | C13H17BrO6 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-(4-bromo-3-methoxyphenyl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)ccc1Br |
| InChI | InChI=1S/C13H17BrO6/c1-19-8-4-6(2-3-7(8)14)13-12(18)11(17)10(16)9(5-15)20-13/h2-4,9-13,15-18H,5H2,1H3/t9-,10-,11+,12+,13-/m1/s1 |
| InChIKey | MDCLLPSANBYCPY-NAWOPXAZSA-N |
| XLogP | -0.03 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |