C18H25ClO7 — CID 58596990
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 58596990) has the molecular formula C18H25ClO7 and a molecular weight of 388.84 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58596990 |
| Molecular Formula | C18H25ClO7 |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1S,3R)-3-methoxycyclopentyl]oxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CO[C@@H]1CC[C@H](Oc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)C1 |
| InChI | InChI=1S/C18H25ClO7/c1-24-10-3-4-11(7-10)25-13-6-9(2-5-12(13)19)18-17(23)16(22)15(21)14(8-20)26-18/h2,5-6,10-11,14-18,20-23H,3-4,7-8H2,1H3/t10-,11+,14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | LFYZBEFDGCQNEM-CHKUFISUSA-N |
| XLogP | 0.80 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |