C22H34O7 — CID 58597057
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-(4-propan-2-yloxycyclohexyl)oxyphenyl]oxane-3,4,5-triol (PubChem CID 58597057) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-(4-propan-2-yloxycyclohexyl)oxyphenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-(4-propan-2-yloxycyclohexyl)oxyphenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58597057 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-(4-propan-2-yloxycyclohexyl)oxyphenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1OC1CCC(OC(C)C)CC1 |
| InChI | InChI=1S/C22H34O7/c1-12(2)27-15-6-8-16(9-7-15)28-17-10-14(5-4-13(17)3)22-21(26)20(25)19(24)18(11-23)29-22/h4-5,10,12,15-16,18-26H,6-9,11H2,1-3H3/t15?,16?,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | WNCCNJUDLAMYIL-XDWHMKSOSA-N |
| XLogP | 1.62 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |