C23H35ClO6 — CID 143181935
(2S,3R,5S,6R)-2-[3-(4-tert-butylcyclohexyl)oxy-4-chlorophenyl]-6-(methoxymethyl)oxane-3,4,5-triol (PubChem CID 143181935) has the molecular formula C23H35ClO6 and a molecular weight of 442.98 g/mol. Its IUPAC name is (2S,3R,5S,6R)-2-[3-(4-tert-butylcyclohexyl)oxy-4-chlorophenyl]-6-(methoxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,5S,6R)-2-[3-(4-tert-butylcyclohexyl)oxy-4-chlorophenyl]-6-(methoxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 143181935 |
| Molecular Formula | C23H35ClO6 |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2S,3R,5S,6R)-2-[3-(4-tert-butylcyclohexyl)oxy-4-chlorophenyl]-6-(methoxymethyl)oxane-3,4,5-triol |
| SMILES | COC[C@H]1O[C@@H](c2ccc(Cl)c(OC3CCC(C(C)(C)C)CC3)c2)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C23H35ClO6/c1-23(2,3)14-6-8-15(9-7-14)29-17-11-13(5-10-16(17)24)22-21(27)20(26)19(25)18(30-22)12-28-4/h5,10-11,14-15,18-22,25-27H,6-9,12H2,1-4H3/t14?,15?,18-,19-,20?,21-,22+/m1/s1 |
| InChIKey | ZCJDDJZWIWQOEA-PDQAAKFWSA-N |
| XLogP | 3.49 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |