C19H27ClO8 — CID 69195545
(2S,3R,4S,5S,6R)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 69195545) has the molecular formula C19H27ClO8 and a molecular weight of 418.87 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69195545 |
| Molecular Formula | C19H27ClO8 |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | COC1CCC(Oc2cc([C@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H27ClO8/c1-26-11-3-5-12(6-4-11)27-14-8-10(2-7-13(14)20)19(25)18(24)17(23)16(22)15(9-21)28-19/h2,7-8,11-12,15-18,21-25H,3-6,9H2,1H3/t11?,12?,15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | BVOZUYJLXINXTG-UFEWFIOWSA-N |
| XLogP | 0.30 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |