C20H21ClF2O7 — CID 140545173
(2R,3R,4S,5S,6R)-2-[4-chloro-3-[(2,6-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140545173) has the molecular formula C20H21ClF2O7 and a molecular weight of 446.83 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(2,6-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(2,6-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140545173 |
| Molecular Formula | C20H21ClF2O7 |
| Molecular Weight | 446.83 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(2,6-difluoro-4-methoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | COc1cc(F)c(Cc2cc([C@@]3(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C20H21ClF2O7/c1-29-11-6-14(22)12(15(23)7-11)5-9-4-10(2-3-13(9)21)20(28)19(27)18(26)17(25)16(8-24)30-20/h2-4,6-7,16-19,24-28H,5,8H2,1H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | AOYBKNFXBKOFLC-OUUBHVDSSA-N |
| XLogP | 0.84 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.83 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |