C22H21ClFNO6S — CID 163864974
(2S,3R,5S)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 163864974) has the molecular formula C22H21ClFNO6S and a molecular weight of 481.93 g/mol. Its IUPAC name is (2S,3R,5S)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,5S)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 163864974 |
| Molecular Formula | C22H21ClFNO6S |
| Molecular Weight | 481.93 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | (2S,3R,5S)-2-[4-chloro-3-[[5-(6-fluoro-3-pyridinyl)thiophen-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OCC1O[C@@](O)(c2ccc(Cl)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C22H21ClFNO6S/c23-15-4-2-13(22(30)21(29)20(28)19(27)16(10-26)31-22)7-12(15)8-14-3-5-17(32-14)11-1-6-18(24)25-9-11/h1-7,9,16,19-21,26-30H,8,10H2/t16?,19-,20?,21-,22+/m1/s1 |
| InChIKey | PFWBKDBAOLCEEX-QXXVGLHZSA-N |
| XLogP | 1.81 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.93 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|