C23H23ClN2O7 — CID 140509295
(2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyrimidin-5-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140509295) has the molecular formula C23H23ClN2O7 and a molecular weight of 474.90 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyrimidin-5-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyrimidin-5-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140509295 |
| Molecular Formula | C23H23ClN2O7 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-chloro-3-[(4-pyrimidin-5-yloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@](O)(c2ccc(Cl)c(Cc3ccc(Oc4cncnc4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H23ClN2O7/c24-18-6-3-15(23(31)22(30)21(29)20(28)19(11-27)33-23)8-14(18)7-13-1-4-16(5-2-13)32-17-9-25-12-26-10-17/h1-6,8-10,12,19-22,27-31H,7,11H2/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | LEXQEXWOZSJCRU-XNBWIAOKSA-N |
| XLogP | 1.13 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |