C23H27ClO7 — CID 24952984
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 24952984) has the molecular formula C23H27ClO7 and a molecular weight of 450.92 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 24952984 |
| Molecular Formula | C23H27ClO7 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-cyclobutyloxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@](O)(c2ccc(Cl)c(Cc3ccc(OC4CCC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27ClO7/c24-18-9-6-15(23(29)22(28)21(27)20(26)19(12-25)31-23)11-14(18)10-13-4-7-17(8-5-13)30-16-2-1-3-16/h4-9,11,16,19-22,25-29H,1-3,10,12H2/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | WXYNATOYTSYKGF-ZQGJOIPISA-N |
| XLogP | 1.48 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |