C26H31ClO8 — CID 90127754
(3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-oxaspiro[3.3]heptan-6-yloxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 90127754) has the molecular formula C26H31ClO8 and a molecular weight of 506.98 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-oxaspiro[3.3]heptan-6-yloxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-oxaspiro[3.3]heptan-6-yloxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 90127754 |
| Molecular Formula | C26H31ClO8 |
| Molecular Weight | 506.98 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-oxaspiro[3.3]heptan-6-yloxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | COC1(c2ccc(Cl)c(Cc3ccc(OC4CC5(COC5)C4)cc3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H31ClO8/c1-32-26(24(31)23(30)22(29)21(12-28)35-26)17-4-7-20(27)16(9-17)8-15-2-5-18(6-3-15)34-19-10-25(11-19)13-33-14-25/h2-7,9,19,21-24,28-31H,8,10-14H2,1H3/t21-,22-,23+,24-,26?/m1/s1 |
| InChIKey | RXJGJOMSBXSDFQ-HGXYQMEISA-N |
| XLogP | 1.76 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.98 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |