C22H27ClO6 — CID 67891768
(2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane-3,4,5-triol (PubChem CID 67891768) has the molecular formula C22H27ClO6 and a molecular weight of 422.91 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 67891768 |
| Molecular Formula | C22H27ClO6 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)O[C@H](C)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H27ClO6/c1-4-28-17-8-5-14(6-9-17)11-15-12-16(7-10-18(15)23)22(27-3)21(26)20(25)19(24)13(2)29-22/h5-10,12-13,19-21,24-26H,4,11H2,1-3H3/t13-,19-,20+,21-,22+/m1/s1 |
| InChIKey | RFWRLVCFNAIFFC-YKQWKKEUSA-N |
| XLogP | 2.63 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |