C34H51ClO6 — CID 118457822
3,4,5-tributoxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane (PubChem CID 118457822) has the molecular formula C34H51ClO6 and a molecular weight of 591.23 g/mol. Its IUPAC name is 3,4,5-tributoxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane.
| Compound Name | 3,4,5-tributoxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane |
|---|---|
| PubChem CID | 118457822 |
| Molecular Formula | C34H51ClO6 |
| Molecular Weight | 591.23 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | 3,4,5-tributoxy-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-methoxy-6-methyloxane |
| SMILES | CCCCOC1C(C)OC(OC)(c2ccc(Cl)c(Cc3ccc(OCC)cc3)c2)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C34H51ClO6/c1-7-11-20-38-31-25(5)41-34(36-6,33(40-22-13-9-3)32(31)39-21-12-8-2)28-16-19-30(35)27(24-28)23-26-14-17-29(18-15-26)37-10-4/h14-19,24-25,31-33H,7-13,20-23H2,1-6H3 |
| InChIKey | MSDDSVTVQCTHBL-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.23 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|