C43H43ClO7 — CID 154726746
[2-chloro-5-[(2S,3R,4S,5R,6R)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone (PubChem CID 154726746) has the molecular formula C43H43ClO7 and a molecular weight of 707.26 g/mol. Its IUPAC name is [2-chloro-5-[(2S,3R,4S,5R,6R)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone.
| Compound Name | [2-chloro-5-[(2S,3R,4S,5R,6R)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone |
|---|---|
| PubChem CID | 154726746 |
| Molecular Formula | C43H43ClO7 |
| Molecular Weight | 707.26 g/mol |
| Exact Mass | 706.27 |
| IUPAC Name | [2-chloro-5-[(2S,3R,4S,5R,6R)-2-methoxy-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]phenyl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2cc([C@]3(OC)O[C@H](C)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C43H43ClO7/c1-4-47-36-23-20-34(21-24-36)39(45)37-26-35(22-25-38(37)44)43(46-3)42(50-29-33-18-12-7-13-19-33)41(49-28-32-16-10-6-11-17-32)40(30(2)51-43)48-27-31-14-8-5-9-15-31/h5-26,30,40-42H,4,27-29H2,1-3H3/t30-,40-,41+,42-,43+/m1/s1 |
| InChIKey | UQXBDCJPMGYHMX-QYSAPVJHSA-N |
| XLogP | 8.94 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.26 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |