C39H40ClIO8 — CID 144798028
[(2R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-5-iodo-6-methoxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 144798028) has the molecular formula C39H40ClIO8 and a molecular weight of 799.10 g/mol. Its IUPAC name is [(2R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-5-iodo-6-methoxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-5-iodo-6-methoxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 144798028 |
| Molecular Formula | C39H40ClIO8 |
| Molecular Weight | 799.10 g/mol |
| Exact Mass | 798.15 |
| IUPAC Name | [(2R,4S,6S)-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2-formyl-5-iodo-6-methoxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)O[C@](C=O)(COC(C)=O)C(OCc4ccccc4)[C@H](OCc4ccccc4)C3I)ccc2Cl)cc1 |
| InChI | InChI=1S/C39H40ClIO8/c1-4-45-33-18-15-28(16-19-33)21-31-22-32(17-20-34(31)40)39(44-3)36(41)35(46-23-29-11-7-5-8-12-29)37(47-24-30-13-9-6-10-14-30)38(25-42,49-39)26-48-27(2)43/h5-20,22,25,35-37H,4,21,23-24,26H2,1-3H3/t35-,36?,37?,38-,39+/m1/s1 |
| InChIKey | VZYIZIJDWMNUAG-VYGHRIMPSA-N |
| XLogP | 7.63 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.10 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|