C49H51ClO10 — CID 144812551
2,2-dimethylpropanoyloxymethyl (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 144812551) has the molecular formula C49H51ClO10 and a molecular weight of 835.39 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 144812551 |
| Molecular Formula | C49H51ClO10 |
| Molecular Weight | 835.39 g/mol |
| Exact Mass | 834.32 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (1S,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@](C(=O)OCOC(=O)C(C)(C)C)(O3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C49H51ClO10/c1-5-53-40-24-21-34(22-25-40)27-38-28-39(23-26-41(38)50)49-44(56-31-37-19-13-8-14-20-37)42(54-29-35-15-9-6-10-16-35)43(55-30-36-17-11-7-12-18-36)48(60-49,32-59-49)46(52)58-33-57-45(51)47(2,3)4/h6-26,28,42-44H,5,27,29-33H2,1-4H3/t42-,43-,44+,48-,49-/m0/s1 |
| InChIKey | NCIRTSXWJJJRAS-NEWXVQTGSA-N |
| XLogP | 9.13 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.39 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|