C46H47ClO8 — CID 121281841
[(1S,2S,3S,4R,5R)-5-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol (PubChem CID 121281841) has the molecular formula C46H47ClO8 and a molecular weight of 763.33 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R)-5-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol.
| Compound Name | [(1S,2S,3S,4R,5R)-5-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol |
|---|---|
| PubChem CID | 121281841 |
| Molecular Formula | C46H47ClO8 |
| Molecular Weight | 763.33 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | [(1S,2S,3S,4R,5R)-5-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol |
| SMILES | OC[C@@]12CO[C@](c3ccc(Cl)c(Cc4ccc(OCCOC5CC5)cc4)c3)(O1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C46H47ClO8/c47-41-23-18-38(27-37(41)26-33-16-19-39(20-17-33)49-24-25-50-40-21-22-40)46-44(53-30-36-14-8-3-9-15-36)42(51-28-34-10-4-1-5-11-34)43(45(31-48,55-46)32-54-46)52-29-35-12-6-2-7-13-35/h1-20,23,27,40,42-44,48H,21-22,24-26,28-32H2/t42-,43-,44+,45-,46+/m0/s1 |
| InChIKey | MGOMYKMOAMRHNS-XWLHOAQLSA-N |
| XLogP | 8.19 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.33 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|