C42H39ClF2O7 — CID 86685114
[(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol (PubChem CID 86685114) has the molecular formula C42H39ClF2O7 and a molecular weight of 729.22 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol.
| Compound Name | [(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol |
|---|---|
| PubChem CID | 86685114 |
| Molecular Formula | C42H39ClF2O7 |
| Molecular Weight | 729.22 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | [(1S,2S,3S,4R,5S)-5-[4-chloro-3-[(2,3-difluoro-4-methoxyphenyl)methyl]phenyl]-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-1-yl]methanol |
| SMILES | COc1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2Cl)c(F)c1F |
| InChI | InChI=1S/C42H39ClF2O7/c1-47-35-20-17-31(36(44)37(35)45)21-32-22-33(18-19-34(32)43)42-40(50-25-30-15-9-4-10-16-30)38(48-23-28-11-5-2-6-12-28)39(41(26-46,52-42)27-51-42)49-24-29-13-7-3-8-14-29/h2-20,22,38-40,46H,21,23-27H2,1H3/t38-,39-,40+,41-,42-/m0/s1 |
| InChIKey | CFDZJBMBSJSDDI-SRWPCTQNSA-N |
| XLogP | 7.92 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.22 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |