C44H45ClF2O8 — CID 118377800
[(3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 118377800) has the molecular formula C44H45ClF2O8 and a molecular weight of 775.29 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 118377800 |
| Molecular Formula | C44H45ClF2O8 |
| Molecular Weight | 775.29 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | [(3R,4S,5R,6S)-6-[4-chloro-3-[(4-ethoxy-2,3-difluorophenyl)methyl]phenyl]-2-(hydroxymethyl)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)OC(CO)(CO)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)c(F)c1F |
| InChI | InChI=1S/C44H45ClF2O8/c1-3-51-37-22-19-33(38(46)39(37)47)23-34-24-35(20-21-36(34)45)44(50-2)42(54-27-32-17-11-6-12-18-32)40(52-25-30-13-7-4-8-14-30)41(43(28-48,29-49)55-44)53-26-31-15-9-5-10-16-31/h4-22,24,40-42,48-49H,3,23,25-29H2,1-2H3/t40-,41+,42+,44-/m0/s1 |
| InChIKey | XEKCDAZLPFCXME-XGHYLEMPSA-N |
| XLogP | 7.92 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.29 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |