C43H42ClFO7 — CID 144747204
(5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-6,7,8-tris(phenylmethoxy)-1,4-dioxaspiro[2.5]octane (PubChem CID 144747204) has the molecular formula C43H42ClFO7 and a molecular weight of 725.25 g/mol. Its IUPAC name is (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-6,7,8-tris(phenylmethoxy)-1,4-dioxaspiro[2.5]octane.
| Compound Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-6,7,8-tris(phenylmethoxy)-1,4-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 144747204 |
| Molecular Formula | C43H42ClFO7 |
| Molecular Weight | 725.25 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | (5S,6R,7R,8S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-5-methoxy-6,7,8-tris(phenylmethoxy)-1,4-dioxaspiro[2.5]octane |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)OC4(CO4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1F |
| InChI | InChI=1S/C43H42ClFO7/c1-3-47-38-22-19-33(24-37(38)45)23-34-25-35(20-21-36(34)44)43(46-2)41(50-28-32-17-11-6-12-18-32)39(48-26-30-13-7-4-8-14-30)40(42(52-43)29-51-42)49-27-31-15-9-5-10-16-31/h4-22,24-25,39-41H,3,23,26-29H2,1-2H3/t39-,40-,41+,42?,43-/m0/s1 |
| InChIKey | WEKTXYYMJKWULZ-GEDGEQESSA-N |
| XLogP | 8.78 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.25 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|