C23H26ClFO7 — CID 144812979
(1R,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 144812979) has the molecular formula C23H26ClFO7 and a molecular weight of 468.91 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 144812979 |
| Molecular Formula | C23H26ClFO7 |
| Molecular Weight | 468.91 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (1R,2S,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@]([C@H](C)O)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1F |
| InChI | InChI=1S/C23H26ClFO7/c1-3-30-18-7-4-13(9-17(18)25)8-14-10-15(5-6-16(14)24)23-21(29)19(27)20(28)22(32-23,11-31-23)12(2)26/h4-7,9-10,12,19-21,26-29H,3,8,11H2,1-2H3/t12-,19-,20-,21+,22+,23-/m0/s1 |
| InChIKey | CHYVMCLTMQDPMN-BLFYESSGSA-N |
| XLogP | 1.88 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.91 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |