C37H39ClO7 — CID 144812998
(1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-2-ol (PubChem CID 144812998) has the molecular formula C37H39ClO7 and a molecular weight of 631.17 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-2-ol.
| Compound Name | (1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 144812998 |
| Molecular Formula | C37H39ClO7 |
| Molecular Weight | 631.17 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (1R,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-[(1S)-1-hydroxyethyl]-3,4-bis(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-2-ol |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@]([C@H](C)O)(O3)[C@H](O)[C@H](OCc3ccccc3)[C@H]4OCc3ccccc3)ccc2Cl)cc1 |
| InChI | InChI=1S/C37H39ClO7/c1-3-41-31-17-14-26(15-18-31)20-29-21-30(16-19-32(29)38)37-35(43-23-28-12-8-5-9-13-28)33(42-22-27-10-6-4-7-11-27)34(40)36(45-37,24-44-37)25(2)39/h4-19,21,25,33-35,39-40H,3,20,22-24H2,1-2H3/t25-,33-,34+,35+,36+,37-/m0/s1 |
| InChIKey | JFZIZFAKDKZZSO-ONQQRVGQSA-N |
| XLogP | 6.19 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.17 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |