C27H33ClO9 — CID 118377935
1-[(1R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-trihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethyl propan-2-yl carbonate (PubChem CID 118377935) has the molecular formula C27H33ClO9 and a molecular weight of 537.01 g/mol. Its IUPAC name is 1-[(1R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-trihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethyl propan-2-yl carbonate.
| Compound Name | 1-[(1R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-trihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 118377935 |
| Molecular Formula | C27H33ClO9 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 1-[(1R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,4-trihydroxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]ethyl propan-2-yl carbonate |
| SMILES | CCOc1ccc(Cc2cc([C@]34OC[C@@](C(C)OC(=O)OC(C)C)(O3)C(O)[C@H](O)[C@H]4O)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H33ClO9/c1-5-33-20-9-6-17(7-10-20)12-18-13-19(8-11-21(18)28)27-24(31)22(29)23(30)26(37-27,14-34-27)16(4)36-25(32)35-15(2)3/h6-11,13,15-16,22-24,29-31H,5,12,14H2,1-4H3/t16?,22-,23?,24+,26-,27-/m0/s1 |
| InChIKey | IIUGFFPQTWRLNT-BILNBGBMSA-N |
| XLogP | 3.31 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |