C29H30ClO11- — CID 131736408
2-[(1R,2S,3S,4R,5S)-2,4-diacetyloxy-1-(1-acetyloxyethyl)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetate (PubChem CID 131736408) has the molecular formula C29H30ClO11- and a molecular weight of 590.00 g/mol. Its IUPAC name is 2-[(1R,2S,3S,4R,5S)-2,4-diacetyloxy-1-(1-acetyloxyethyl)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetate.
| Compound Name | 2-[(1R,2S,3S,4R,5S)-2,4-diacetyloxy-1-(1-acetyloxyethyl)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetate |
|---|---|
| PubChem CID | 131736408 |
| Molecular Formula | C29H30ClO11- |
| Molecular Weight | 590.00 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | 2-[(1R,2S,3S,4R,5S)-2,4-diacetyloxy-1-(1-acetyloxyethyl)-5-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-3-yl]acetate |
| SMILES | CC(=O)OC(C)[C@@]12CO[C@@](c3ccc(Cl)c(Cc4ccc(O)cc4)c3)(O1)[C@H](OC(C)=O)[C@@H](CC(=O)[O-])[C@@H]2OC(C)=O |
| InChI | InChI=1S/C29H31ClO11/c1-15(38-16(2)31)28-14-37-29(41-28,27(40-18(4)33)23(13-25(35)36)26(28)39-17(3)32)21-7-10-24(30)20(12-21)11-19-5-8-22(34)9-6-19/h5-10,12,15,23,26-27,34H,11,13-14H2,1-4H3,(H,35,36)/p-1/t15?,23-,26-,27+,28+,29-/m0/s1 |
| InChIKey | GCZQQQZHDXLQBR-FTNOUGBZSA-M |
| XLogP | 2.16 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.00 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|