C32H36ClNO11 — CID 86729347
[(1R,2S,3S,4R,5S)-2,3,4-triacetyloxy-5-[4-chloro-3-[[4-(N-ethoxy-C-methylcarbonimidoyl)phenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate (PubChem CID 86729347) has the molecular formula C32H36ClNO11 and a molecular weight of 646.09 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S)-2,3,4-triacetyloxy-5-[4-chloro-3-[[4-(N-ethoxy-C-methylcarbonimidoyl)phenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate.
| Compound Name | [(1R,2S,3S,4R,5S)-2,3,4-triacetyloxy-5-[4-chloro-3-[[4-(N-ethoxy-C-methylcarbonimidoyl)phenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 86729347 |
| Molecular Formula | C32H36ClNO11 |
| Molecular Weight | 646.09 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | [(1R,2S,3S,4R,5S)-2,3,4-triacetyloxy-5-[4-chloro-3-[[4-(N-ethoxy-C-methylcarbonimidoyl)phenyl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octan-1-yl]methyl acetate |
| SMILES | CCON=C(C)c1ccc(Cc2cc([C@]34OC[C@](COC(C)=O)(O3)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C32H36ClNO11/c1-7-41-34-18(2)24-10-8-23(9-11-24)14-25-15-26(12-13-27(25)33)32-30(44-22(6)38)28(42-20(4)36)29(43-21(5)37)31(45-32,17-40-32)16-39-19(3)35/h8-13,15,28-30H,7,14,16-17H2,1-6H3/t28-,29-,30+,31-,32-/m0/s1 |
| InChIKey | KIZDCIMICHBGLR-LUKCZKMGSA-N |
| XLogP | 4.00 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.09 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|