C29H30ClNO7 — CID 129162826
(1S,2S,3R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-methoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 129162826) has the molecular formula C29H30ClNO7 and a molecular weight of 540.01 g/mol. Its IUPAC name is (1S,2S,3R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-methoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2S,3R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-methoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 129162826 |
| Molecular Formula | C29H30ClNO7 |
| Molecular Weight | 540.01 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (1S,2S,3R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-methoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | CO/N=C(/C)c1ccc(Oc2ccc(Cc3cc([C@]45C[C@@H](O)[C@H](O)[C@](CO)(CO4)O5)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C29H30ClNO7/c1-18(31-35-2)20-5-10-24(11-6-20)37-23-8-3-19(4-9-23)13-21-14-22(7-12-25(21)30)29-15-26(33)27(34)28(16-32,38-29)17-36-29/h3-12,14,26-27,32-34H,13,15-17H2,1-2H3/b31-18-/t26-,27+,28+,29-/m1/s1 |
| InChIKey | NSUYSFVXAFVQBT-NDCZYLAMSA-N |
| XLogP | 4.15 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|