C29H29ClO6S — CID 145177282
(1S,2R,4S,6S,9R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-phenyl-2-sulfanyl-3,5,10,12-tetraoxatricyclo[7.2.1.01,6]dodecan-7-ol (PubChem CID 145177282) has the molecular formula C29H29ClO6S and a molecular weight of 541.07 g/mol. Its IUPAC name is (1S,2R,4S,6S,9R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-phenyl-2-sulfanyl-3,5,10,12-tetraoxatricyclo[7.2.1.01,6]dodecan-7-ol.
| Compound Name | (1S,2R,4S,6S,9R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-phenyl-2-sulfanyl-3,5,10,12-tetraoxatricyclo[7.2.1.01,6]dodecan-7-ol |
|---|---|
| PubChem CID | 145177282 |
| Molecular Formula | C29H29ClO6S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | (1S,2R,4S,6S,9R)-9-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-4-phenyl-2-sulfanyl-3,5,10,12-tetraoxatricyclo[7.2.1.01,6]dodecan-7-ol |
| SMILES | CCOc1ccc(Cc2cc([C@]34CC(O)[C@@H]5O[C@H](c6ccccc6)O[C@H](S)[C@@]5(CO3)O4)ccc2Cl)cc1 |
| InChI | InChI=1S/C29H29ClO6S/c1-2-32-22-11-8-18(9-12-22)14-20-15-21(10-13-23(20)30)29-16-24(31)25-28(36-29,17-33-29)27(37)35-26(34-25)19-6-4-3-5-7-19/h3-13,15,24-27,31,37H,2,14,16-17H2,1H3/t24?,25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | LWEDCEWASTVTKX-OYZWNCMESA-N |
| XLogP | 5.40 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|