C28H29ClO6 — CID 130316127
3-[[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]methyl]-6-phenyl-4,4a,8,8a-tetrahydro-3H-[1,2]dioxino[4,3-d][1,3]dioxin-4-ol (PubChem CID 130316127) has the molecular formula C28H29ClO6 and a molecular weight of 496.99 g/mol. Its IUPAC name is 3-[[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]methyl]-6-phenyl-4,4a,8,8a-tetrahydro-3H-[1,2]dioxino[4,3-d][1,3]dioxin-4-ol.
| Compound Name | 3-[[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]methyl]-6-phenyl-4,4a,8,8a-tetrahydro-3H-[1,2]dioxino[4,3-d][1,3]dioxin-4-ol |
|---|---|
| PubChem CID | 130316127 |
| Molecular Formula | C28H29ClO6 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 3-[[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]methyl]-6-phenyl-4,4a,8,8a-tetrahydro-3H-[1,2]dioxino[4,3-d][1,3]dioxin-4-ol |
| SMILES | CCOc1ccc(Cc2cc(CC3OOC4COC(c5ccccc5)OC4C3O)ccc2Cl)cc1 |
| InChI | InChI=1S/C28H29ClO6/c1-2-31-22-11-8-18(9-12-22)14-21-15-19(10-13-23(21)29)16-24-26(30)27-25(35-34-24)17-32-28(33-27)20-6-4-3-5-7-20/h3-13,15,24-28,30H,2,14,16-17H2,1H3 |
| InChIKey | XTNCQBKJVRGQFF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|