C23H27ClO5 — CID 144637106
(9aS)-7-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-9-ol (PubChem CID 144637106) has the molecular formula C23H27ClO5 and a molecular weight of 418.92 g/mol. Its IUPAC name is (9aS)-7-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-9-ol.
| Compound Name | (9aS)-7-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-9-ol |
|---|---|
| PubChem CID | 144637106 |
| Molecular Formula | C23H27ClO5 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (9aS)-7-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-2,3,5,5a,7,8,9,9a-octahydropyrano[3,2-e][1,4]dioxepin-9-ol |
| SMILES | CCOc1ccc(Cc2cc(C3CC(O)[C@@H]4OCCOCC4O3)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H27ClO5/c1-2-27-18-6-3-15(4-7-18)11-17-12-16(5-8-19(17)24)21-13-20(25)23-22(29-21)14-26-9-10-28-23/h3-8,12,20-23,25H,2,9-11,13-14H2,1H3/t20?,21?,22?,23-/m0/s1 |
| InChIKey | HIUVYBHXTMLYRN-JVLTXYAPSA-N |
| XLogP | 3.94 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |