C23H27ClO6 — CID 144747096
(1S,2S,3R,5R)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-ethoxy-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 144747096) has the molecular formula C23H27ClO6 and a molecular weight of 434.92 g/mol. Its IUPAC name is (1S,2S,3R,5R)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-ethoxy-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2S,3R,5R)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-ethoxy-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 144747096 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (1S,2S,3R,5R)-5-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-1-ethoxy-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | CCOc1ccc(Cc2cc([C@]34C[C@@H](O)[C@H](O)[C@](OCC)(CO3)O4)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H27ClO6/c1-3-27-18-8-5-15(6-9-18)11-16-12-17(7-10-19(16)24)22-13-20(25)21(26)23(30-22,14-29-22)28-4-2/h5-10,12,20-21,25-26H,3-4,11,13-14H2,1-2H3/t20-,21+,22-,23+/m1/s1 |
| InChIKey | FEJKPBBXMRPBLI-ACESQOTJSA-N |
| XLogP | 3.39 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |