C29H30ClNO8 — CID 89451599
(1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 89451599) has the molecular formula C29H30ClNO8 and a molecular weight of 556.01 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 89451599 |
| Molecular Formula | C29H30ClNO8 |
| Molecular Weight | 556.01 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[(2E)-2-methoxyimino-2-phenylethoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | CO/N=C(/COc1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H30ClNO8/c1-36-31-24(19-5-3-2-4-6-19)15-37-22-10-7-18(8-11-22)13-20-14-21(9-12-23(20)30)29-27(35)25(33)26(34)28(16-32,39-29)17-38-29/h2-12,14,25-27,32-35H,13,15-17H2,1H3/b31-24-/t25-,26-,27+,28-,29-/m0/s1 |
| InChIKey | CHGBBLZJDMMBGF-GKGLPZIWSA-N |
| XLogP | 2.39 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.01 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|