C23H25NO7 — CID 46181808
2-[(4-ethoxyphenyl)methyl]-4-[(1S,2S,3S,4S,5R)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile (PubChem CID 46181808) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methyl]-4-[(1S,2S,3S,4S,5R)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile.
| Compound Name | 2-[(4-ethoxyphenyl)methyl]-4-[(1S,2S,3S,4S,5R)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile |
|---|---|
| PubChem CID | 46181808 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methyl]-4-[(1S,2S,3S,4S,5R)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile |
| SMILES | CCOc1ccc(Cc2cc([C@@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@@H]4O)ccc2C#N)cc1 |
| InChI | InChI=1S/C23H25NO7/c1-2-29-18-7-3-14(4-8-18)9-16-10-17(6-5-15(16)11-24)23-21(28)19(26)20(27)22(12-25,31-23)13-30-23/h3-8,10,19-21,25-28H,2,9,12-13H2,1H3/t19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | PJNMZPTTZREOHO-XZCBWCRCSA-N |
| XLogP | 0.57 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |