C30H32ClNO8 — CID 71534985
(1S,2R,3S,4R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 71534985) has the molecular formula C30H32ClNO8 and a molecular weight of 570.04 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2R,3S,4R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 71534985 |
| Molecular Formula | C30H32ClNO8 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | (1S,2R,3S,4R,5R)-5-[4-chloro-3-[[4-[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | CCO/N=C(/C)c1ccc(Oc2ccc(Cc3cc([C@@]45OC[C@](CO)(O4)[C@H](O)[C@H](O)[C@H]5O)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C30H32ClNO8/c1-3-38-32-18(2)20-6-11-24(12-7-20)39-23-9-4-19(5-10-23)14-21-15-22(8-13-25(21)31)30-28(36)26(34)27(35)29(16-33,40-30)17-37-30/h4-13,15,26-28,33-36H,3,14,16-17H2,1-2H3/b32-18-/t26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | IIFYUMVJDDUPAU-YHEAIWJISA-N |
| XLogP | 3.51 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|