C28H28ClNO8 — CID 89451474
(1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[4-[(Z)-methoxyiminomethyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 89451474) has the molecular formula C28H28ClNO8 and a molecular weight of 541.98 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[4-[(Z)-methoxyiminomethyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[4-[(Z)-methoxyiminomethyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 89451474 |
| Molecular Formula | C28H28ClNO8 |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-[4-[(Z)-methoxyiminomethyl]phenoxy]phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | CO/N=C\c1ccc(Oc2ccc(Cc3cc([C@]45OC[C@](CO)(O4)[C@@H](O)[C@H](O)[C@H]5O)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H28ClNO8/c1-35-30-14-18-4-9-22(10-5-18)37-21-7-2-17(3-8-21)12-19-13-20(6-11-23(19)29)28-26(34)24(32)25(33)27(15-31,38-28)16-36-28/h2-11,13-14,24-26,31-34H,12,15-16H2,1H3/b30-14-/t24-,25-,26+,27-,28-/m0/s1 |
| InChIKey | QSLUJTWLJGGZFN-VLJRGBHLSA-N |
| XLogP | 2.73 |
| TPSA | 130.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|