C24H26N2O7 — CID 123782285
2-[[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl]-4-[(1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile (PubChem CID 123782285) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 2-[[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl]-4-[(1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile.
| Compound Name | 2-[[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl]-4-[(1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123782285 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[[4-(N-methoxy-C-methylcarbonimidoyl)phenyl]methyl]-4-[(1S,2S,3S,4R,5S)-2,3,4-trihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-5-yl]benzonitrile |
| SMILES | CON=C(C)c1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2C#N)cc1 |
| InChI | InChI=1S/C24H26N2O7/c1-14(26-31-2)16-5-3-15(4-6-16)9-18-10-19(8-7-17(18)11-25)24-22(30)20(28)21(29)23(12-27,33-24)13-32-24/h3-8,10,20-22,27-30H,9,12-13H2,1-2H3/t20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | HAURBRDKQILXSV-LKTXNROYSA-N |
| XLogP | 0.55 |
| TPSA | 144.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|