C23H26ClFO7 — CID 158700762
(1R,2S,3S,4R,5R)-5-[4-chloro-3-[[3-fluoro-4-(1,1,2,2-tetradeuteriopropoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 158700762) has the molecular formula C23H26ClFO7 and a molecular weight of 472.93 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-5-[4-chloro-3-[[3-fluoro-4-(1,1,2,2-tetradeuteriopropoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2S,3S,4R,5R)-5-[4-chloro-3-[[3-fluoro-4-(1,1,2,2-tetradeuteriopropoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 158700762 |
| Molecular Formula | C23H26ClFO7 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (1R,2S,3S,4R,5R)-5-[4-chloro-3-[[3-fluoro-4-(1,1,2,2-tetradeuteriopropoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | [2H]C([2H])(C)C([2H])([2H])Oc1ccc(Cc2cc([C@@]34OC[C@@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1F |
| InChI | InChI=1S/C23H26ClFO7/c1-2-7-30-18-6-3-13(9-17(18)25)8-14-10-15(4-5-16(14)24)23-21(29)19(27)20(28)22(11-26,32-23)12-31-23/h3-6,9-10,19-21,26-29H,2,7-8,11-12H2,1H3/t19-,20-,21+,22+,23+/m0/s1/i2D2,7D2 |
| InChIKey | RSVBEQMAFHOXGQ-ZZBWPQGGSA-N |
| XLogP | 1.89 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |