C23H26ClFO6 — CID 86279668
(1S,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 86279668) has the molecular formula C23H26ClFO6 and a molecular weight of 452.91 g/mol. Its IUPAC name is (1S,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 86279668 |
| Molecular Formula | C23H26ClFO6 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (1S,2R,3S,4R,5S)-5-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | CCOc1ccc(Cc2cc([C@]34C[C@](CO)(CO3)[C@@H](O)[C@H](O)[C@H]4O)ccc2Cl)cc1F |
| InChI | InChI=1S/C23H26ClFO6/c1-2-30-18-6-3-13(8-17(18)25)7-14-9-15(4-5-16(14)24)23-10-22(11-26,12-31-23)20(28)19(27)21(23)29/h3-6,8-9,19-21,26-29H,2,7,10-12H2,1H3/t19-,20-,21+,22-,23-/m0/s1 |
| InChIKey | IDZLFFUDISCKAP-HPAIXVDQSA-N |
| XLogP | 2.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |