C22H24F2O7 — CID 142768598
(1S,2S,3S,4R,5S)-5-[4-fluoro-3-[[3-fluoro-4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 142768598) has the molecular formula C22H24F2O7 and a molecular weight of 443.45 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-fluoro-3-[[3-fluoro-4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-fluoro-3-[[3-fluoro-4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 142768598 |
| Molecular Formula | C22H24F2O7 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-fluoro-3-[[3-fluoro-4-(1,1,2,2,2-pentadeuterioethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])Oc1ccc(Cc2cc([C@]34OC[C@](CO)(O3)[C@@H](O)[C@H](O)[C@H]4O)ccc2F)cc1F |
| InChI | InChI=1S/C22H24F2O7/c1-2-29-17-6-3-12(8-16(17)24)7-13-9-14(4-5-15(13)23)22-20(28)18(26)19(27)21(10-25,31-22)11-30-22/h3-6,8-9,18-20,25-28H,2,7,10-11H2,1H3/t18-,19-,20+,21-,22-/m0/s1/i1D3,2D2 |
| InChIKey | WAJHWTCFFJJASO-BLDWDHEESA-N |
| XLogP | 0.98 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |