C22H23ClF2O6 — CID 141478725
(1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 141478725) has the molecular formula C22H23ClF2O6 and a molecular weight of 456.87 g/mol. Its IUPAC name is (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 141478725 |
| Molecular Formula | C22H23ClF2O6 |
| Molecular Weight | 456.87 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (1S,2S,3S,4R,5S)-5-[4-chloro-3-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-1-(hydroxymethyl)-6-oxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | OC[C@]12CO[C@](c3ccc(Cl)c(Cc4ccc(OC(F)F)cc4)c3)(C1)[C@H](O)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C22H23ClF2O6/c23-16-6-3-14(8-13(16)7-12-1-4-15(5-2-12)31-20(24)25)22-9-21(10-26,11-30-22)18(28)17(27)19(22)29/h1-6,8,17-20,26-29H,7,9-11H2/t17-,18+,19+,21-,22-/m0/s1 |
| InChIKey | PMHVNXCAYCHXGY-YMYKFTITSA-N |
| XLogP | 2.22 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |