C44H46ClFO6 — CID 144747191
(2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-6-ethyl-2-methoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 144747191) has the molecular formula C44H46ClFO6 and a molecular weight of 725.30 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-6-ethyl-2-methoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-6-ethyl-2-methoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 144747191 |
| Molecular Formula | C44H46ClFO6 |
| Molecular Weight | 725.30 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-chloro-3-[(4-ethoxy-3-fluorophenyl)methyl]phenyl]-6-ethyl-2-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CCOc1ccc(Cc2cc([C@]3(OC)O[C@H](CC)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc2Cl)cc1F |
| InChI | InChI=1S/C44H46ClFO6/c1-4-39-41(49-28-31-15-9-6-10-16-31)42(50-29-32-17-11-7-12-18-32)43(51-30-33-19-13-8-14-20-33)44(47-3,52-39)36-22-23-37(45)35(27-36)25-34-21-24-40(48-5-2)38(46)26-34/h6-24,26-27,39,41-43H,4-5,25,28-30H2,1-3H3/t39-,41-,42+,43-,44+/m1/s1 |
| InChIKey | LRQNUVYKDAOUKL-ZCCIZBBCSA-N |
| XLogP | 9.83 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.30 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |