C49H57ClF2O7Si — CID 86685168
tert-butyl-[[(2R,3R,4S,5R,6S)-6-[4-chloro-3-[[4-(2,2-difluoroethoxy)phenyl]methyl]phenyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane (PubChem CID 86685168) has the molecular formula C49H57ClF2O7Si and a molecular weight of 859.52 g/mol. Its IUPAC name is tert-butyl-[[(2R,3R,4S,5R,6S)-6-[4-chloro-3-[[4-(2,2-difluoroethoxy)phenyl]methyl]phenyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3R,4S,5R,6S)-6-[4-chloro-3-[[4-(2,2-difluoroethoxy)phenyl]methyl]phenyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 86685168 |
| Molecular Formula | C49H57ClF2O7Si |
| Molecular Weight | 859.52 g/mol |
| Exact Mass | 858.35 |
| IUPAC Name | tert-butyl-[[(2R,3R,4S,5R,6S)-6-[4-chloro-3-[[4-(2,2-difluoroethoxy)phenyl]methyl]phenyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]-dimethylsilane |
| SMILES | CO[C@@]1(c2ccc(Cl)c(Cc3ccc(OCC(F)F)cc3)c2)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H57ClF2O7Si/c1-48(2,3)60(5,6)58-33-43-45(55-30-36-16-10-7-11-17-36)46(56-31-37-18-12-8-13-19-37)47(57-32-38-20-14-9-15-21-38)49(53-4,59-43)40-24-27-42(50)39(29-40)28-35-22-25-41(26-23-35)54-34-44(51)52/h7-27,29,43-47H,28,30-34H2,1-6H3/t43-,45-,46+,47-,49+/m1/s1 |
| InChIKey | AAOSMAPFCBMISF-QKFIWPOISA-N |
| XLogP | 11.55 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.52 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|