C54H62O7Si — CID 143282407
(3R,5R,6R)-2-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 143282407) has the molecular formula C54H62O7Si and a molecular weight of 851.17 g/mol. Its IUPAC name is (3R,5R,6R)-2-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,5R,6R)-2-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 143282407 |
| Molecular Formula | C54H62O7Si |
| Molecular Weight | 851.17 g/mol |
| Exact Mass | 850.43 |
| IUPAC Name | (3R,5R,6R)-2-[3-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]methyl]-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | Cc1ccc(C2(O)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)[C@H]2OCc2ccccc2)cc1Cc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C54H62O7Si/c1-40-27-30-47(34-46(40)33-41-28-31-48(32-29-41)61-62(5,6)53(2,3)4)54(55)52(59-38-45-25-17-10-18-26-45)51(58-37-44-23-15-9-16-24-44)50(57-36-43-21-13-8-14-22-43)49(60-54)39-56-35-42-19-11-7-12-20-42/h7-32,34,49-52,55H,33,35-39H2,1-6H3/t49-,50-,51?,52-,54?/m1/s1 |
| InChIKey | SYDWUNZXGDDWRJ-PHXPSGJISA-N |
| XLogP | 11.49 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.17 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|