C56H54BrNO7 — CID 86655201
(3R,4S,5R,6R)-2-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 86655201) has the molecular formula C56H54BrNO7 and a molecular weight of 932.95 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 86655201 |
| Molecular Formula | C56H54BrNO7 |
| Molecular Weight | 932.95 g/mol |
| Exact Mass | 931.31 |
| IUPAC Name | (3R,4S,5R,6R)-2-[3-[(4-benzyl-2,3-dihydro-1,4-benzoxazin-6-yl)methyl]-4-bromophenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC1(c2ccc(Br)c(Cc3ccc4c(c3)N(Cc3ccccc3)CCO4)c2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C56H54BrNO7/c57-49-28-27-48(34-47(49)32-46-26-29-51-50(33-46)58(30-31-61-51)35-41-16-6-1-7-17-41)56(59)55(64-39-45-24-14-5-15-25-45)54(63-38-44-22-12-4-13-23-44)53(62-37-43-20-10-3-11-21-43)52(65-56)40-60-36-42-18-8-2-9-19-42/h1-29,33-34,52-55,59H,30-32,35-40H2/t52-,53-,54+,55-,56?/m1/s1 |
| InChIKey | KPBHJRFRKPMOST-UNXRTQJZSA-N |
| XLogP | 10.96 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.95 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |