C51H51BrO7 — CID 86714018
(3R,4S,5R,6R)-2-[7-bromo-6-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 86714018) has the molecular formula C51H51BrO7 and a molecular weight of 855.87 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[7-bromo-6-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[7-bromo-6-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 86714018 |
| Molecular Formula | C51H51BrO7 |
| Molecular Weight | 855.87 g/mol |
| Exact Mass | 854.28 |
| IUPAC Name | (3R,4S,5R,6R)-2-[7-bromo-6-[(4-methoxyphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | COc1ccc(Cc2cc(C3(O)O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c3c(c2Br)CCC3)cc1 |
| InChI | InChI=1S/C51H51BrO7/c1-54-42-27-25-36(26-28-42)29-41-30-45(43-23-14-24-44(43)47(41)52)51(53)50(58-34-40-21-12-5-13-22-40)49(57-33-39-19-10-4-11-20-39)48(56-32-38-17-8-3-9-18-38)46(59-51)35-55-31-37-15-6-2-7-16-37/h2-13,15-22,25-28,30,46,48-50,53H,14,23-24,29,31-35H2,1H3/t46-,48-,49+,50-,51?/m1/s1 |
| InChIKey | YYSKTUZACHBXQJ-LPDCFGRQSA-N |
| XLogP | 10.05 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.87 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |