C49H47FO7 — CID 142728706
(3R,4S,5R,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 142728706) has the molecular formula C49H47FO7 and a molecular weight of 766.91 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 142728706 |
| Molecular Formula | C49H47FO7 |
| Molecular Weight | 766.91 g/mol |
| Exact Mass | 766.33 |
| IUPAC Name | (3R,4S,5R,6R)-2-[7-[(4-fluorophenyl)methyl]-2,3-dihydro-1-benzofuran-5-yl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC1(c2cc3c(c(Cc4ccc(F)cc4)c2)OCC3)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H47FO7/c50-43-23-21-35(22-24-43)27-41-29-42(28-40-25-26-53-45(40)41)49(51)48(56-33-39-19-11-4-12-20-39)47(55-32-38-17-9-3-10-18-38)46(54-31-37-15-7-2-8-16-37)44(57-49)34-52-30-36-13-5-1-6-14-36/h1-24,28-29,44,46-48,51H,25-27,30-34H2/t44-,46-,47+,48-,49?/m1/s1 |
| InChIKey | DWZWZNWQVRPLFS-QFXKNAONSA-N |
| XLogP | 8.87 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.91 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |