C58H61ClO8Si — CID 90073223
(3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 90073223) has the molecular formula C58H61ClO8Si and a molecular weight of 949.66 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 90073223 |
| Molecular Formula | C58H61ClO8Si |
| Molecular Weight | 949.66 g/mol |
| Exact Mass | 948.38 |
| IUPAC Name | (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-methoxyphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | COc1cc(C2(O)O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1Cl |
| InChI | InChI=1S/C58H61ClO8Si/c1-57(2,3)68(49-31-19-9-20-32-49,50-33-21-10-22-34-50)66-41-47-35-48(36-51(61-4)53(47)59)58(60)56(65-40-46-29-17-8-18-30-46)55(64-39-45-27-15-7-16-28-45)54(63-38-44-25-13-6-14-26-44)52(67-58)42-62-37-43-23-11-5-12-24-43/h5-36,52,54-56,60H,37-42H2,1-4H3/t52-,54-,55+,56-,58?/m1/s1 |
| InChIKey | AIGJAZAMFMANKP-LATCDPSOSA-N |
| XLogP | 10.94 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.66 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|