C39H61ClO6Si4 — CID 58242645
(3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-ol (PubChem CID 58242645) has the molecular formula C39H61ClO6Si4 and a molecular weight of 773.71 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-ol |
|---|---|
| PubChem CID | 58242645 |
| Molecular Formula | C39H61ClO6Si4 |
| Molecular Weight | 773.71 g/mol |
| Exact Mass | 772.32 |
| IUPAC Name | (3R,4S,5R,6R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-ethyl-3,4,5-tris(trimethylsilyloxy)oxan-2-ol |
| SMILES | CC[C@H]1OC(O)(c2ccc(Cl)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C39H61ClO6Si4/c1-14-34-35(44-47(5,6)7)36(45-48(8,9)10)37(46-49(11,12)13)39(41,43-34)30-25-26-33(40)29(27-30)28-42-50(38(2,3)4,31-21-17-15-18-22-31)32-23-19-16-20-24-32/h15-27,34-37,41H,14,28H2,1-13H3/t34-,35-,36+,37-,39?/m1/s1 |
| InChIKey | XICXJAGYWMGQDB-CXLNXTHGSA-N |
| XLogP | 9.03 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.71 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|