C30H37ClO7Si — CID 58446364
(4S,5R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 58446364) has the molecular formula C30H37ClO7Si and a molecular weight of 573.16 g/mol. Its IUPAC name is (4S,5R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (4S,5R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 58446364 |
| Molecular Formula | C30H37ClO7Si |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | (4S,5R)-2-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chlorophenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | COC1(c2ccc(Cl)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C30H37ClO7Si/c1-29(2,3)39(22-11-7-5-8-12-22,23-13-9-6-10-14-23)37-19-20-17-21(15-16-24(20)31)30(36-4)28(35)27(34)26(33)25(18-32)38-30/h5-17,25-28,32-35H,18-19H2,1-4H3/t25?,26-,27-,28?,30?/m0/s1 |
| InChIKey | HOSXHIDAYFALDJ-OGUGJIFTSA-N |
| XLogP | 2.69 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|