C30H37ClO7Si — CID 90291666
(3R,4S,5S,6R)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (PubChem CID 90291666) has the molecular formula C30H37ClO7Si and a molecular weight of 573.16 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 90291666 |
| Molecular Formula | C30H37ClO7Si |
| Molecular Weight | 573.16 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]phenyl]-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| SMILES | COC1(c2ccc(Cl)c(CCC(C)(C)[Si](O)(c3ccccc3)c3ccccc3)c2)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C30H37ClO7Si/c1-29(2,39(36,22-10-6-4-7-11-22)23-12-8-5-9-13-23)17-16-20-18-21(14-15-24(20)31)30(37-3)28(35)27(34)26(33)25(19-32)38-30/h4-15,18,25-28,32-36H,16-17,19H2,1-3H3/t25-,26-,27+,28-,30?/m1/s1 |
| InChIKey | DBLYALIDXUHJMB-VAUJRCAMSA-N |
| XLogP | 2.08 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|